C9H6F13NO2 — CID 139724210
2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanamide (PubChem CID 139724210) has the molecular formula C9H6F13NO2 and a molecular weight of 407.13 g/mol. Its IUPAC name is 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanamide.
| Compound Name | 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanamide |
|---|---|
| PubChem CID | 139724210 |
| Molecular Formula | C9H6F13NO2 |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 2,2,3,5,5,5-hexafluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxymethyl)pentanamide |
| SMILES | NC(=O)C(F)(F)C(F)C(COC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F13NO2/c10-3(5(11,12)4(23)24)2(6(13,14)15)1-25-7(16,8(17,18)19)9(20,21)22/h2-3H,1H2,(H2,23,24) |
| InChIKey | SANIXASJFPHOMQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |