C5H10F4N2O2 — CID 170876394
3-amino-4,5,5,5-tetrafluoropentanamide;hydrate (PubChem CID 170876394) has the molecular formula C5H10F4N2O2 and a molecular weight of 206.14 g/mol. Its IUPAC name is 3-amino-4,5,5,5-tetrafluoropentanamide;hydrate.
| Compound Name | 3-amino-4,5,5,5-tetrafluoropentanamide;hydrate |
|---|---|
| PubChem CID | 170876394 |
| Molecular Formula | C5H10F4N2O2 |
| Molecular Weight | 206.14 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-amino-4,5,5,5-tetrafluoropentanamide;hydrate |
| SMILES | NC(=O)CC(N)C(F)C(F)(F)F.O |
| InChI | InChI=1S/C5H8F4N2O.H2O/c6-4(5(7,8)9)2(10)1-3(11)12;/h2,4H,1,10H2,(H2,11,12);1H2 |
| InChIKey | JBLMJAWSAVFOLX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.14 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |