C5H12N2O3 — CID 55255995
(4S)-3-amino-4,5-dihydroxypentanamide (PubChem CID 55255995) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is (4S)-3-amino-4,5-dihydroxypentanamide.
| Compound Name | (4S)-3-amino-4,5-dihydroxypentanamide |
|---|---|
| PubChem CID | 55255995 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (4S)-3-amino-4,5-dihydroxypentanamide |
| SMILES | NC(=O)CC(N)[C@H](O)CO |
| InChI | InChI=1S/C5H12N2O3/c6-3(1-5(7)10)4(9)2-8/h3-4,8-9H,1-2,6H2,(H2,7,10)/t3?,4-/m1/s1 |
| InChIKey | NOLLPCDKIAQUJS-SRBOSORUSA-N |
| XLogP | -2.46 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |