About 1-aminoethanol;2-hydroxyacetamide
1-aminoethanol;2-hydroxyacetamide (PubChem CID 160904835) has the molecular formula C4H12N2O3
and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-aminoethanol;2-hydroxyacetamide.
Molecular Properties
| Compound Name | 1-aminoethanol;2-hydroxyacetamide |
| PubChem CID | 160904835 |
| Molecular Formula | C4H12N2O3 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | 1-aminoethanol;2-hydroxyacetamide |
| SMILES | CC(N)O.NC(=O)CO |
| InChI | InChI=1S/C2H5NO2.C2H7NO/c3-2(5)1-4;1-2(3)4/h4H,1H2,(H2,3,5);2,4H,3H2,1H3 |
| InChIKey | SPZQHHDWWQZDFQ-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethanol;2-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethanol;2-hydroxyacetamide?
The IUPAC name of 1-aminoethanol;2-hydroxyacetamide (CID 160904835) is 1-aminoethanol;2-hydroxyacetamide.
What is the SMILES notation for 1-aminoethanol;2-hydroxyacetamide?
The canonical SMILES for 1-aminoethanol;2-hydroxyacetamide is CC(N)O.NC(=O)CO.
What is the InChIKey of 1-aminoethanol;2-hydroxyacetamide?
The InChIKey is SPZQHHDWWQZDFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H7NO/c3-2(5)1-4;1-2(3)4/h4H,1H2,(H2,3,5);2,4H,3H2,1H3.
What are the key properties of 1-aminoethanol;2-hydroxyacetamide?
1-aminoethanol;2-hydroxyacetamide has a molecular weight of 136.15 g/mol, XLogP of -2.25, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanol;2-hydroxyacetamide is sourced from PubChem (CID 160904835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).