C10H23N3O5 — CID 22555881
1-aminoethanol;N',N'-bis(2-hydroxyethyl)butanediamide (PubChem CID 22555881) has the molecular formula C10H23N3O5 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-aminoethanol;N',N'-bis(2-hydroxyethyl)butanediamide.
| Compound Name | 1-aminoethanol;N',N'-bis(2-hydroxyethyl)butanediamide |
|---|---|
| PubChem CID | 22555881 |
| Molecular Formula | C10H23N3O5 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-aminoethanol;N',N'-bis(2-hydroxyethyl)butanediamide |
| SMILES | CC(N)O.NC(=O)CCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C8H16N2O4.C2H7NO/c9-7(13)1-2-8(14)10(3-5-11)4-6-12;1-2(3)4/h11-12H,1-6H2,(H2,9,13);2,4H,3H2,1H3 |
| InChIKey | MMYDHRQSEIGLSK-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|