C7H15N3O2S — CID 4638963
3-[2-hydroxyethyl(methylcarbamothioyl)amino]propanamide (PubChem CID 4638963) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methylcarbamothioyl)amino]propanamide.
| Compound Name | 3-[2-hydroxyethyl(methylcarbamothioyl)amino]propanamide |
|---|---|
| PubChem CID | 4638963 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[2-hydroxyethyl(methylcarbamothioyl)amino]propanamide |
| SMILES | CNC(=S)N(CCO)CCC(N)=O |
| InChI | InChI=1S/C7H15N3O2S/c1-9-7(13)10(4-5-11)3-2-6(8)12/h11H,2-5H2,1H3,(H2,8,12)(H,9,13) |
| InChIKey | TYZDPPWSNHRVSD-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|