About 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane)
3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) (PubChem CID 145273853) has the molecular formula C15H35N3O2
and a molecular weight of 289.46 g/mol. Its IUPAC name is 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane).
Molecular Properties
| Compound Name | 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) |
| PubChem CID | 145273853 |
| Molecular Formula | C15H35N3O2 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.27 |
| IUPAC Name | 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) |
| SMILES | CC(C)C.CC(C)C.CN(CCC(N)=O)CCC(N)=O |
| InChI | InChI=1S/C7H15N3O2.2C4H10/c1-10(4-2-6(8)11)5-3-7(9)12;2*1-4(2)3/h2-5H2,1H3,(H2,8,11)(H2,9,12);2*4H,1-3H3 |
| InChIKey | VYPYBRLVAILKCN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane)?
The IUPAC name of 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) (CID 145273853) is 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane).
What is the SMILES notation for 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane)?
The canonical SMILES for 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) is CC(C)C.CC(C)C.CN(CCC(N)=O)CCC(N)=O.
What is the InChIKey of 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane)?
The InChIKey is VYPYBRLVAILKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2.2C4H10/c1-10(4-2-6(8)11)5-3-7(9)12;2*1-4(2)3/h2-5H2,1H3,(H2,8,11)(H2,9,12);2*4H,1-3H3.
What are the key properties of 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane)?
3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) has a molecular weight of 289.46 g/mol, XLogP of 1.99, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-amino-3-oxopropyl)-methylamino]propanamide;bis(2-methylpropane) is sourced from PubChem (CID 145273853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).