C9H20N2O4 — CID 175159738
hexanediamide;propane-1,2-diol (PubChem CID 175159738) has the molecular formula C9H20N2O4 and a molecular weight of 220.27 g/mol. Its IUPAC name is hexanediamide;propane-1,2-diol.
| Compound Name | hexanediamide;propane-1,2-diol |
|---|---|
| PubChem CID | 175159738 |
| Molecular Formula | C9H20N2O4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | hexanediamide;propane-1,2-diol |
| SMILES | CC(O)CO.NC(=O)CCCCC(N)=O |
| InChI | InChI=1S/C6H12N2O2.C3H8O2/c7-5(9)3-1-2-4-6(8)10;1-3(5)2-4/h1-4H2,(H2,7,9)(H2,8,10);3-5H,2H2,1H3 |
| InChIKey | XPRFRWDTNNADRQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|