C12H25NO2 — CID 174403190
10-hydroxy-7,9-dimethyldecanamide (PubChem CID 174403190) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 10-hydroxy-7,9-dimethyldecanamide.
| Compound Name | 10-hydroxy-7,9-dimethyldecanamide |
|---|---|
| PubChem CID | 174403190 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 10-hydroxy-7,9-dimethyldecanamide |
| SMILES | CC(CO)CC(C)CCCCCC(N)=O |
| InChI | InChI=1S/C12H25NO2/c1-10(8-11(2)9-14)6-4-3-5-7-12(13)15/h10-11,14H,3-9H2,1-2H3,(H2,13,15) |
| InChIKey | PJLZEBFFEQVXCW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|