C21H35NO2 — CID 18431719
(9E,11E,13E,15E)-20-hydroxy-19-methylicosa-9,11,13,15-tetraenamide (PubChem CID 18431719) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is (9E,11E,13E,15E)-20-hydroxy-19-methylicosa-9,11,13,15-tetraenamide.
| Compound Name | (9E,11E,13E,15E)-20-hydroxy-19-methylicosa-9,11,13,15-tetraenamide |
|---|---|
| PubChem CID | 18431719 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | (9E,11E,13E,15E)-20-hydroxy-19-methylicosa-9,11,13,15-tetraenamide |
| SMILES | CC(CO)CC/C=C/C=C/C=C/C=C/CCCCCCCC(N)=O |
| InChI | InChI=1S/C21H35NO2/c1-20(19-23)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-21(22)24/h2-5,7,9,11,13,20,23H,6,8,10,12,14-19H2,1H3,(H2,22,24)/b4-2+,5-3+,9-7+,13-11+ |
| InChIKey | ZLTMNNWCFSWEHW-IWMRCULNSA-N |
| XLogP | 4.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|