C23H39NO2 — CID 91405814
(21R)-22-hydroxy-21-methyldocosa-5,8,11,14-tetraenamide (PubChem CID 91405814) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (21R)-22-hydroxy-21-methyldocosa-5,8,11,14-tetraenamide.
| Compound Name | (21R)-22-hydroxy-21-methyldocosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 91405814 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (21R)-22-hydroxy-21-methyldocosa-5,8,11,14-tetraenamide |
| SMILES | C[C@@H](CO)CCCCCC=CCC=CCC=CCC=CCCCC(N)=O |
| InChI | InChI=1S/C23H39NO2/c1-22(21-25)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-23(24)26/h2-3,6-9,12,14,22,25H,4-5,10-11,13,15-21H2,1H3,(H2,24,26)/t22-/m1/s1 |
| InChIKey | ALTNWGOJIDDQPH-JOCHJYFZSA-N |
| XLogP | 5.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|