C19H34O — CID 91232731
2-methyloctadeca-9,12,15-trien-1-ol (PubChem CID 91232731) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 2-methyloctadeca-9,12,15-trien-1-ol.
| Compound Name | 2-methyloctadeca-9,12,15-trien-1-ol |
|---|---|
| PubChem CID | 91232731 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 2-methyloctadeca-9,12,15-trien-1-ol |
| SMILES | CCC=CCC=CCC=CCCCCCCC(C)CO |
| InChI | InChI=1S/C19H34O/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(2)18-20/h4-5,7-8,10-11,19-20H,3,6,9,12-18H2,1-2H3 |
| InChIKey | ZZEZXCPBXZJPAG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|