C23H38 — CID 173133172
(3Z,6Z,9Z,12Z,15Z)-21-methyldocosa-3,6,9,12,15-pentaene (PubChem CID 173133172) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z)-21-methyldocosa-3,6,9,12,15-pentaene.
| Compound Name | (3Z,6Z,9Z,12Z,15Z)-21-methyldocosa-3,6,9,12,15-pentaene |
|---|---|
| PubChem CID | 173133172 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z)-21-methyldocosa-3,6,9,12,15-pentaene |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(C)C |
| InChI | InChI=1S/C23H38/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(2)3/h5-6,8-9,11-12,14-15,17-18,23H,4,7,10,13,16,19-22H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17- |
| InChIKey | KHGNKRMOBFJNCM-AAQCHOMXSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|