C23H38OS — CID 91061901
2-methylsulfanyldocosa-7,10,13,16,19-pentaen-1-ol (PubChem CID 91061901) has the molecular formula C23H38OS and a molecular weight of 362.62 g/mol. Its IUPAC name is 2-methylsulfanyldocosa-7,10,13,16,19-pentaen-1-ol.
| Compound Name | 2-methylsulfanyldocosa-7,10,13,16,19-pentaen-1-ol |
|---|---|
| PubChem CID | 91061901 |
| Molecular Formula | C23H38OS |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 2-methylsulfanyldocosa-7,10,13,16,19-pentaen-1-ol |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCC(CO)SC |
| InChI | InChI=1S/C23H38OS/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(22-24)25-2/h4-5,7-8,10-11,13-14,16-17,23-24H,3,6,9,12,15,18-22H2,1-2H3 |
| InChIKey | YRRVPOVKKTXLOY-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|