C11H20N2O3S — CID 55037634
1-carbamothioyl-N,N-bis(2-hydroxyethyl)cyclopentane-1-carboxamide (PubChem CID 55037634) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-carbamothioyl-N,N-bis(2-hydroxyethyl)cyclopentane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N,N-bis(2-hydroxyethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55037634 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-carbamothioyl-N,N-bis(2-hydroxyethyl)cyclopentane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)N(CCO)CCO)CCCC1 |
| InChI | InChI=1S/C11H20N2O3S/c12-9(17)11(3-1-2-4-11)10(16)13(5-7-14)6-8-15/h14-15H,1-8H2,(H2,12,17) |
| InChIKey | HUNWIBAUFOKWPZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|