C13H22F2N2O2S — CID 107479760
1-carbamothioyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cycloheptane-1-carboxamide (PubChem CID 107479760) has the molecular formula C13H22F2N2O2S and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cycloheptane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 107479760 |
| Molecular Formula | C13H22F2N2O2S |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-carbamothioyl-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)cycloheptane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)N(CCO)CC(F)F)CCCCCC1 |
| InChI | InChI=1S/C13H22F2N2O2S/c14-10(15)9-17(7-8-18)12(19)13(11(16)20)5-3-1-2-4-6-13/h10,18H,1-9H2,(H2,16,20) |
| InChIKey | QGDXFAOUVVVBMU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|