C8H16N4O6Pd — CID 3531876
bis(2,4-diamino-4-oxobutanoic acid);palladium (PubChem CID 3531876) has the molecular formula C8H16N4O6Pd and a molecular weight of 370.66 g/mol. Its IUPAC name is bis(2,4-diamino-4-oxobutanoic acid);palladium.
| Compound Name | bis(2,4-diamino-4-oxobutanoic acid);palladium |
|---|---|
| PubChem CID | 3531876 |
| Molecular Formula | C8H16N4O6Pd |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | bis(2,4-diamino-4-oxobutanoic acid);palladium |
| SMILES | NC(=O)CC(N)C(=O)O.NC(=O)CC(N)C(=O)O.[Pd] |
| InChI | InChI=1S/2C4H8N2O3.Pd/c2*5-2(4(8)9)1-3(6)7;/h2*2H,1,5H2,(H2,6,7)(H,8,9); |
| InChIKey | KSYVGGOFRATTQZ-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |