C4H10MgN2O3 — CID 174719447
magnesium;(2S)-2,4-diamino-4-oxobutanoic acid;hydride (PubChem CID 174719447) has the molecular formula C4H10MgN2O3 and a molecular weight of 158.44 g/mol. Its IUPAC name is magnesium;(2S)-2,4-diamino-4-oxobutanoic acid;hydride.
| Compound Name | magnesium;(2S)-2,4-diamino-4-oxobutanoic acid;hydride |
|---|---|
| PubChem CID | 174719447 |
| Molecular Formula | C4H10MgN2O3 |
| Molecular Weight | 158.44 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | magnesium;(2S)-2,4-diamino-4-oxobutanoic acid;hydride |
| SMILES | NC(=O)C[C@H](N)C(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C4H8N2O3.Mg.2H/c5-2(4(8)9)1-3(6)7;;;/h2H,1,5H2,(H2,6,7)(H,8,9);;;/q;+2;2*-1/t2-;;;/m0.../s1 |
| InChIKey | ZOXLZJVLCXIONR-SQGDDOFFSA-N |
| XLogP | -1.88 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.44 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |