C6H15N3O4 — CID 174977424
2-aminoethanol;2,4-diamino-4-oxobutanoic acid (PubChem CID 174977424) has the molecular formula C6H15N3O4 and a molecular weight of 193.20 g/mol. Its IUPAC name is 2-aminoethanol;2,4-diamino-4-oxobutanoic acid.
| Compound Name | 2-aminoethanol;2,4-diamino-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174977424 |
| Molecular Formula | C6H15N3O4 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-aminoethanol;2,4-diamino-4-oxobutanoic acid |
| SMILES | NC(=O)CC(N)C(=O)O.NCCO |
| InChI | InChI=1S/C4H8N2O3.C2H7NO/c5-2(4(8)9)1-3(6)7;3-1-2-4/h2H,1,5H2,(H2,6,7)(H,8,9);4H,1-3H2 |
| InChIKey | XNSUBLQKPJGIKE-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |