C13H25N5O10 — CID 87695022
(2S)-2-aminopentanedioic acid;bis((2S)-2,4-diamino-4-oxobutanoic acid) (PubChem CID 87695022) has the molecular formula C13H25N5O10 and a molecular weight of 411.37 g/mol. Its IUPAC name is (2S)-2-aminopentanedioic acid;bis((2S)-2,4-diamino-4-oxobutanoic acid).
| Compound Name | (2S)-2-aminopentanedioic acid;bis((2S)-2,4-diamino-4-oxobutanoic acid) |
|---|---|
| PubChem CID | 87695022 |
| Molecular Formula | C13H25N5O10 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (2S)-2-aminopentanedioic acid;bis((2S)-2,4-diamino-4-oxobutanoic acid) |
| SMILES | NC(=O)C[C@H](N)C(=O)O.NC(=O)C[C@H](N)C(=O)O.N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4.2C4H8N2O3/c6-3(5(9)10)1-2-4(7)8;2*5-2(4(8)9)1-3(6)7/h3H,1-2,6H2,(H,7,8)(H,9,10);2*2H,1,5H2,(H2,6,7)(H,8,9)/t3-;2*2-/m000/s1 |
| InChIKey | JDAQTUOCYKAESH-CZIDNERZSA-N |
| XLogP | -4.19 |
| TPSA | 313.44 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |