C5H9F3N2O — CID 124668584
(3S)-4,4,4-trifluoro-3-(methylamino)butanamide (PubChem CID 124668584) has the molecular formula C5H9F3N2O and a molecular weight of 170.13 g/mol. Its IUPAC name is (3S)-4,4,4-trifluoro-3-(methylamino)butanamide.
| Compound Name | (3S)-4,4,4-trifluoro-3-(methylamino)butanamide |
|---|---|
| PubChem CID | 124668584 |
| Molecular Formula | C5H9F3N2O |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (3S)-4,4,4-trifluoro-3-(methylamino)butanamide |
| SMILES | CN[C@@H](CC(N)=O)C(F)(F)F |
| InChI | InChI=1S/C5H9F3N2O/c1-10-3(2-4(9)11)5(6,7)8/h3,10H,2H2,1H3,(H2,9,11)/t3-/m0/s1 |
| InChIKey | FRSVBXSYZSVJSI-VKHMYHEASA-N |
| XLogP | 0.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |