C9H8F12N2O — CID 170876102
3-amino-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanamide (PubChem CID 170876102) has the molecular formula C9H8F12N2O and a molecular weight of 388.15 g/mol. Its IUPAC name is 3-amino-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanamide.
| Compound Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanamide |
|---|---|
| PubChem CID | 170876102 |
| Molecular Formula | C9H8F12N2O |
| Molecular Weight | 388.15 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 3-amino-4,4,5,5,6,6,7,7,8,8,9,9-dodecafluorononanamide |
| SMILES | NC(=O)CC(N)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H8F12N2O/c10-4(11)6(14,15)8(18,19)9(20,21)7(16,17)5(12,13)2(22)1-3(23)24/h2,4H,1,22H2,(H2,23,24) |
| InChIKey | RQVNVZBRJGQYJR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.15 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|