C9H3F15O3 — CID 89413924
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctyl hydrogen carbonate (PubChem CID 89413924) has the molecular formula C9H3F15O3 and a molecular weight of 444.09 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctyl hydrogen carbonate.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctyl hydrogen carbonate |
|---|---|
| PubChem CID | 89413924 |
| Molecular Formula | C9H3F15O3 |
| Molecular Weight | 444.09 g/mol |
| Exact Mass | 443.98 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-pentadecafluorooctyl hydrogen carbonate |
| SMILES | O=C(O)OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H3F15O3/c10-1(11)4(13,14)6(17,18)8(21,22)9(23,24)7(19,20)5(15,16)2(12)27-3(25)26/h1-2H,(H,25,26) |
| InChIKey | MCYDHJBTFCDXJB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.09 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|