C15H2F28O3 — CID 163324597
2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-octadecafluorononoxy)hexanoic acid (PubChem CID 163324597) has the molecular formula C15H2F28O3 and a molecular weight of 762.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-octadecafluorononoxy)hexanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-octadecafluorononoxy)hexanoic acid |
|---|---|
| PubChem CID | 163324597 |
| Molecular Formula | C15H2F28O3 |
| Molecular Weight | 762.12 g/mol |
| Exact Mass | 761.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-6-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-octadecafluorononoxy)hexanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H2F28O3/c16-1(17)3(18,19)5(22,23)7(26,27)9(30,31)10(32,33)11(34,35)13(38,39)15(42,43)46-14(40,41)12(36,37)8(28,29)6(24,25)4(20,21)2(44)45/h1H,(H,44,45) |
| InChIKey | ZZSXLKPVVPGLDY-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.12 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|