C7HF12IO — CID 2776135
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl iodide (PubChem CID 2776135) has the molecular formula C7HF12IO and a molecular weight of 455.96 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl iodide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl iodide |
|---|---|
| PubChem CID | 2776135 |
| Molecular Formula | C7HF12IO |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 455.89 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoyl iodide |
| SMILES | O=C(I)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7HF12IO/c8-1(9)3(10,11)5(14,15)7(18,19)6(16,17)4(12,13)2(20)21/h1H |
| InChIKey | QDBXDEBHXUNRMW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|