C10H7F12NO — CID 3089677
N-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide (PubChem CID 3089677) has the molecular formula C10H7F12NO and a molecular weight of 385.15 g/mol. Its IUPAC name is N-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide.
| Compound Name | N-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
|---|---|
| PubChem CID | 3089677 |
| Molecular Formula | C10H7F12NO |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | N-cyclopropyl-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanamide |
| SMILES | O=C(NC1CC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H7F12NO/c11-4(12)6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(24)23-3-1-2-3/h3-4H,1-2H2,(H,23,24) |
| InChIKey | HRVVWMWIXQAFRJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|