C12H16F7NO — CID 573411
N-cyclooctyl-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 573411) has the molecular formula C12H16F7NO and a molecular weight of 323.25 g/mol. Its IUPAC name is N-cyclooctyl-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-cyclooctyl-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 573411 |
| Molecular Formula | C12H16F7NO |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-cyclooctyl-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C(NC1CCCCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F7NO/c13-10(14,11(15,16)12(17,18)19)9(21)20-8-6-4-2-1-3-5-7-8/h8H,1-7H2,(H,20,21) |
| InChIKey | STFNIQCRBWVNAZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|