C14H19F7N2O2 — CID 177402658
N-[(1R,2R)-2-(butanoylamino)cyclohexyl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 177402658) has the molecular formula C14H19F7N2O2 and a molecular weight of 380.30 g/mol. Its IUPAC name is N-[(1R,2R)-2-(butanoylamino)cyclohexyl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[(1R,2R)-2-(butanoylamino)cyclohexyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 177402658 |
| Molecular Formula | C14H19F7N2O2 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[(1R,2R)-2-(butanoylamino)cyclohexyl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CCCC(=O)N[C@@H]1CCCC[C@H]1NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F7N2O2/c1-2-5-10(24)22-8-6-3-4-7-9(8)23-11(25)12(15,16)13(17,18)14(19,20)21/h8-9H,2-7H2,1H3,(H,22,24)(H,23,25)/t8-,9-/m1/s1 |
| InChIKey | TUSQHUOHCCRDFW-RKDXNWHRSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|