C16H20F8N2O2 — CID 4201164
N,N'-dicyclopentyl-2,2,3,3,4,4,5,5-octafluorohexanediamide (PubChem CID 4201164) has the molecular formula C16H20F8N2O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is N,N'-dicyclopentyl-2,2,3,3,4,4,5,5-octafluorohexanediamide.
| Compound Name | N,N'-dicyclopentyl-2,2,3,3,4,4,5,5-octafluorohexanediamide |
|---|---|
| PubChem CID | 4201164 |
| Molecular Formula | C16H20F8N2O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N,N'-dicyclopentyl-2,2,3,3,4,4,5,5-octafluorohexanediamide |
| SMILES | O=C(NC1CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20F8N2O2/c17-13(18,11(27)25-9-5-1-2-6-9)15(21,22)16(23,24)14(19,20)12(28)26-10-7-3-4-8-10/h9-10H,1-8H2,(H,25,27)(H,26,28) |
| InChIKey | ISOLMXGIRCCJRF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|