C16HF31O2 — CID 87145953
fluoro 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-triacontafluorohexadecanoate (PubChem CID 87145953) has the molecular formula C16HF31O2 and a molecular weight of 814.12 g/mol. Its IUPAC name is fluoro 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-triacontafluorohexadecanoate.
| Compound Name | fluoro 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-triacontafluorohexadecanoate |
|---|---|
| PubChem CID | 87145953 |
| Molecular Formula | C16HF31O2 |
| Molecular Weight | 814.12 g/mol |
| Exact Mass | 813.95 |
| IUPAC Name | fluoro 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-triacontafluorohexadecanoate |
| SMILES | O=C(OF)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16HF31O2/c17-1(18)3(19,20)5(23,24)7(27,28)9(31,32)11(35,36)13(39,40)15(43,44)16(45,46)14(41,42)12(37,38)10(33,34)8(29,30)6(25,26)4(21,22)2(48)49-47/h1H |
| InChIKey | BKZSNYNDJOOHFP-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.12 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|