C15H18F12N2O2 — CID 158319787
2-(3-ethyl-2H-imidazol-1-yl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate;methane (PubChem CID 158319787) has the molecular formula C15H18F12N2O2 and a molecular weight of 486.30 g/mol. Its IUPAC name is 2-(3-ethyl-2H-imidazol-1-yl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate;methane.
| Compound Name | 2-(3-ethyl-2H-imidazol-1-yl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate;methane |
|---|---|
| PubChem CID | 158319787 |
| Molecular Formula | C15H18F12N2O2 |
| Molecular Weight | 486.30 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-(3-ethyl-2H-imidazol-1-yl)ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate;methane |
| SMILES | C.CCN1C=CN(CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C14H14F12N2O2.CH4/c1-2-27-3-4-28(7-27)5-6-30-9(29)11(19,20)13(23,24)14(25,26)12(21,22)10(17,18)8(15)16;/h3-4,8H,2,5-7H2,1H3;1H4 |
| InChIKey | GORYHXMJLNBWOG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|