C13H22F8N2O4S — CID 87843292
1-butyl-3-methyl-2H-imidazole;1,1,2,2,3,3,4,4-octafluoropentane;sulfuric acid (PubChem CID 87843292) has the molecular formula C13H22F8N2O4S and a molecular weight of 454.38 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;1,1,2,2,3,3,4,4-octafluoropentane;sulfuric acid.
| Compound Name | 1-butyl-3-methyl-2H-imidazole;1,1,2,2,3,3,4,4-octafluoropentane;sulfuric acid |
|---|---|
| PubChem CID | 87843292 |
| Molecular Formula | C13H22F8N2O4S |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;1,1,2,2,3,3,4,4-octafluoropentane;sulfuric acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)F.CCCCN1C=CN(C)C1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H16N2.C5H4F8.H2O4S/c1-3-4-5-10-7-6-9(2)8-10;1-3(8,9)5(12,13)4(10,11)2(6)7;1-5(2,3)4/h6-7H,3-5,8H2,1-2H3;2H,1H3;(H2,1,2,3,4) |
| InChIKey | XIJSCLYYNFPWFC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|