C18H36N2O7 — CID 174749863
1-ethyl-3-(2-methoxyethyl)-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid (PubChem CID 174749863) has the molecular formula C18H36N2O7 and a molecular weight of 392.49 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 174749863 |
| Molecular Formula | C18H36N2O7 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid |
| SMILES | CCN1C=CN(CCOC)C1.COCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C10H20O6.C8H16N2O/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-3-9-4-5-10(8-9)6-7-11-2/h2-9H2,1H3,(H,11,12);4-5H,3,6-8H2,1-2H3 |
| InChIKey | HCFNJMNXKZZIKH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|