C15H27NO5 — CID 174749758
1-(2-ethoxyethyl)-2H-pyridine;3-(2-methoxyethoxy)propanoic acid (PubChem CID 174749758) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-2H-pyridine;3-(2-methoxyethoxy)propanoic acid.
| Compound Name | 1-(2-ethoxyethyl)-2H-pyridine;3-(2-methoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 174749758 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(2-ethoxyethyl)-2H-pyridine;3-(2-methoxyethoxy)propanoic acid |
| SMILES | CCOCCN1C=CC=CC1.COCCOCCC(=O)O |
| InChI | InChI=1S/C9H15NO.C6H12O4/c1-2-11-9-8-10-6-4-3-5-7-10;1-9-4-5-10-3-2-6(7)8/h3-6H,2,7-9H2,1H3;2-5H2,1H3,(H,7,8) |
| InChIKey | UZPSJKAFWGQCLM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|