C19H38N2O7 — CID 174750047
1-(2-ethoxyethyl)-3-ethyl-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid (PubChem CID 174750047) has the molecular formula C19H38N2O7 and a molecular weight of 406.52 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-ethyl-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid.
| Compound Name | 1-(2-ethoxyethyl)-3-ethyl-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 174750047 |
| Molecular Formula | C19H38N2O7 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-ethyl-2H-imidazole;3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid |
| SMILES | CCOCCN1C=CN(CC)C1.COCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C10H20O6.C9H18N2O/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12;1-3-10-5-6-11(9-10)7-8-12-4-2/h2-9H2,1H3,(H,11,12);5-6H,3-4,7-9H2,1-2H3 |
| InChIKey | SCNLEVBAPGWLLO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|