C19H36N2O7 — CID 118645477
[1-(2-ethoxyethyl)-3-ethyl-2H-imidazol-2-yl] 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate (PubChem CID 118645477) has the molecular formula C19H36N2O7 and a molecular weight of 404.50 g/mol. Its IUPAC name is [1-(2-ethoxyethyl)-3-ethyl-2H-imidazol-2-yl] 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate.
| Compound Name | [1-(2-ethoxyethyl)-3-ethyl-2H-imidazol-2-yl] 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 118645477 |
| Molecular Formula | C19H36N2O7 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | [1-(2-ethoxyethyl)-3-ethyl-2H-imidazol-2-yl] 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
| SMILES | CCOCCN1C=CN(CC)C1OC(=O)CCOCCOCCOCCOC |
| InChI | InChI=1S/C19H36N2O7/c1-4-20-7-8-21(9-11-24-5-2)19(20)28-18(22)6-10-25-14-15-27-17-16-26-13-12-23-3/h7-8,19H,4-6,9-17H2,1-3H3 |
| InChIKey | LBWOAKUOXZGPKR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|