C14H28N2O5 — CID 174749773
1-(2-ethoxyethyl)-3-methyl-2H-imidazole;3-(2-methoxyethoxy)propanoic acid (PubChem CID 174749773) has the molecular formula C14H28N2O5 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-methyl-2H-imidazole;3-(2-methoxyethoxy)propanoic acid.
| Compound Name | 1-(2-ethoxyethyl)-3-methyl-2H-imidazole;3-(2-methoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 174749773 |
| Molecular Formula | C14H28N2O5 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-methyl-2H-imidazole;3-(2-methoxyethoxy)propanoic acid |
| SMILES | CCOCCN1C=CN(C)C1.COCCOCCC(=O)O |
| InChI | InChI=1S/C8H16N2O.C6H12O4/c1-3-11-7-6-10-5-4-9(2)8-10;1-9-4-5-10-3-2-6(7)8/h4-5H,3,6-8H2,1-2H3;2-5H2,1H3,(H,7,8) |
| InChIKey | KTHJBZYWUVTJOU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|