About [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate
[diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate (PubChem CID 118645060) has the molecular formula C17H37O6P
and a molecular weight of 368.45 g/mol. Its IUPAC name is [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate.
Molecular Properties
| Compound Name | [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate |
| PubChem CID | 118645060 |
| Molecular Formula | C17H37O6P |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate |
| SMILES | CCOCCOCCC(=O)OP(C)(CC)(CC)CCOCCOC |
| InChI | InChI=1S/C17H37O6P/c1-6-20-13-14-21-10-9-17(18)23-24(5,7-2,8-3)16-15-22-12-11-19-4/h6-16H2,1-5H3 |
| InChIKey | HPSXGUTTWQIYNT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate?
The IUPAC name of [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate (CID 118645060) is [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate.
What is the SMILES notation for [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate?
The canonical SMILES for [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate is CCOCCOCCC(=O)OP(C)(CC)(CC)CCOCCOC.
What is the InChIKey of [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate?
The InChIKey is HPSXGUTTWQIYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37O6P/c1-6-20-13-14-21-10-9-17(18)23-24(5,7-2,8-3)16-15-22-12-11-19-4/h6-16H2,1-5H3.
What are the key properties of [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate?
[diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate has a molecular weight of 368.45 g/mol, XLogP of 2.77, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-ethoxyethoxy)propanoate is sourced from PubChem (CID 118645060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).