C16H35O6P — CID 118645007
[diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate (PubChem CID 118645007) has the molecular formula C16H35O6P and a molecular weight of 354.42 g/mol. Its IUPAC name is [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate.
| Compound Name | [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate |
|---|---|
| PubChem CID | 118645007 |
| Molecular Formula | C16H35O6P |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [diethyl-[2-(2-methoxyethoxy)ethyl]-methyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate |
| SMILES | CCP(C)(CC)(CCOCCOC)OC(=O)CCOCCOC |
| InChI | InChI=1S/C16H35O6P/c1-6-23(5,7-2,15-14-21-13-11-19-4)22-16(17)8-9-20-12-10-18-3/h6-15H2,1-5H3 |
| InChIKey | WFLWHUICTQOJCF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|