C14H31O6P — CID 118645705
[bis(2-methoxyethyl)-dimethyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate (PubChem CID 118645705) has the molecular formula C14H31O6P and a molecular weight of 326.37 g/mol. Its IUPAC name is [bis(2-methoxyethyl)-dimethyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate.
| Compound Name | [bis(2-methoxyethyl)-dimethyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate |
|---|---|
| PubChem CID | 118645705 |
| Molecular Formula | C14H31O6P |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [bis(2-methoxyethyl)-dimethyl-λ5-phosphanyl] 3-(2-methoxyethoxy)propanoate |
| SMILES | COCCOCCC(=O)OP(C)(C)(CCOC)CCOC |
| InChI | InChI=1S/C14H31O6P/c1-16-8-9-19-7-6-14(15)20-21(4,5,12-10-17-2)13-11-18-3/h6-13H2,1-5H3 |
| InChIKey | CIEWKXXHRCTOQN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|