C12H26O6S2 — CID 160861388
2-(2-methoxyethoxy)ethanethiol;3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid (PubChem CID 160861388) has the molecular formula C12H26O6S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethanethiol;3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid.
| Compound Name | 2-(2-methoxyethoxy)ethanethiol;3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 160861388 |
| Molecular Formula | C12H26O6S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(2-methoxyethoxy)ethanethiol;3-[2-(2-sulfanylethoxy)ethoxy]propanoic acid |
| SMILES | COCCOCCS.O=C(O)CCOCCOCCS |
| InChI | InChI=1S/C7H14O4S.C5H12O2S/c8-7(9)1-2-10-3-4-11-5-6-12;1-6-2-3-7-4-5-8/h12H,1-6H2,(H,8,9);8H,2-5H2,1H3 |
| InChIKey | SKNONDGJXMENBV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|