C5H10O3S — CID 19987106
3-(2-sulfanylethoxy)propanoic acid (PubChem CID 19987106) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is 3-(2-sulfanylethoxy)propanoic acid.
| Compound Name | 3-(2-sulfanylethoxy)propanoic acid |
|---|---|
| PubChem CID | 19987106 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 3-(2-sulfanylethoxy)propanoic acid |
| SMILES | O=C(O)CCOCCS |
| InChI | InChI=1S/C5H10O3S/c6-5(7)1-2-8-3-4-9/h9H,1-4H2,(H,6,7) |
| InChIKey | ZSOWTTJLZBIPQR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|