C18H23F17O2 — CID 91096390
propyl 2,2-dimethylbutanoate;tetrafluoromethane;1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane (PubChem CID 91096390) has the molecular formula C18H23F17O2 and a molecular weight of 594.35 g/mol. Its IUPAC name is propyl 2,2-dimethylbutanoate;tetrafluoromethane;1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane.
| Compound Name | propyl 2,2-dimethylbutanoate;tetrafluoromethane;1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane |
|---|---|
| PubChem CID | 91096390 |
| Molecular Formula | C18H23F17O2 |
| Molecular Weight | 594.35 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | propyl 2,2-dimethylbutanoate;tetrafluoromethane;1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctane |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.CCCOC(=O)C(C)(C)CC.FC(F)(F)F |
| InChI | InChI=1S/C9H18O2.C8H5F13.CF4/c1-5-7-11-8(10)9(3,4)6-2;1-2(9)4(12,13)6(16,17)8(20,21)7(18,19)5(14,15)3(10)11;2-1(3,4)5/h5-7H2,1-4H3;2-3H,1H3; |
| InChIKey | FWGZGLIPHFNKTN-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.35 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|