C14H11F16NO — CID 3430081
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-1-piperidin-1-ylnonan-1-one (PubChem CID 3430081) has the molecular formula C14H11F16NO and a molecular weight of 513.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-1-piperidin-1-ylnonan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-1-piperidin-1-ylnonan-1-one |
|---|---|
| PubChem CID | 3430081 |
| Molecular Formula | C14H11F16NO |
| Molecular Weight | 513.22 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-1-piperidin-1-ylnonan-1-one |
| SMILES | O=C(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H11F16NO/c15-6(16)8(17,18)10(21,22)12(25,26)14(29,30)13(27,28)11(23,24)9(19,20)7(32)31-4-2-1-3-5-31/h6H,1-5H2 |
| InChIKey | JJLKUIZXJIAJNY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.22 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|