C17H24F6N2O2 — CID 5093018
1,5-bis(azepan-1-yl)-2,2,3,3,4,4-hexafluoropentane-1,5-dione (PubChem CID 5093018) has the molecular formula C17H24F6N2O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is 1,5-bis(azepan-1-yl)-2,2,3,3,4,4-hexafluoropentane-1,5-dione.
| Compound Name | 1,5-bis(azepan-1-yl)-2,2,3,3,4,4-hexafluoropentane-1,5-dione |
|---|---|
| PubChem CID | 5093018 |
| Molecular Formula | C17H24F6N2O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1,5-bis(azepan-1-yl)-2,2,3,3,4,4-hexafluoropentane-1,5-dione |
| SMILES | O=C(N1CCCCCC1)C(F)(F)C(F)(F)C(F)(F)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C17H24F6N2O2/c18-15(19,13(26)24-9-5-1-2-6-10-24)17(22,23)16(20,21)14(27)25-11-7-3-4-8-12-25/h1-12H2 |
| InChIKey | VOYYKCFCAWOJAA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|