C16H20F8N2O2 — CID 3095784
2,2,3,3,4,4,5,5-octafluoro-1,6-di(piperidin-1-yl)hexane-1,6-dione (PubChem CID 3095784) has the molecular formula C16H20F8N2O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1,6-di(piperidin-1-yl)hexane-1,6-dione.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1,6-di(piperidin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 3095784 |
| Molecular Formula | C16H20F8N2O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1,6-di(piperidin-1-yl)hexane-1,6-dione |
| SMILES | O=C(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H20F8N2O2/c17-13(18,11(27)25-7-3-1-4-8-25)15(21,22)16(23,24)14(19,20)12(28)26-9-5-2-6-10-26/h1-10H2 |
| InChIKey | NTSZSUHUGKHJJN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|