C15H13ClF16N2O — CID 4120977
9-chloro-1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one (PubChem CID 4120977) has the molecular formula C15H13ClF16N2O and a molecular weight of 576.70 g/mol. Its IUPAC name is 9-chloro-1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one.
| Compound Name | 9-chloro-1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
|---|---|
| PubChem CID | 4120977 |
| Molecular Formula | C15H13ClF16N2O |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | 9-chloro-1-(4-ethylpiperazin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononan-1-one |
| SMILES | CCN1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)CC1 |
| InChI | InChI=1S/C15H13ClF16N2O/c1-2-33-3-5-34(6-4-33)7(35)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)15(16,31)32/h2-6H2,1H3 |
| InChIKey | TUSRUMVVCXJGII-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|