C14H15F12NO — CID 3506780
1-(2,6-dimethylpiperidin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one (PubChem CID 3506780) has the molecular formula C14H15F12NO and a molecular weight of 441.26 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one |
|---|---|
| PubChem CID | 3506780 |
| Molecular Formula | C14H15F12NO |
| Molecular Weight | 441.26 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptan-1-one |
| SMILES | CC1CCCC(C)N1C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H15F12NO/c1-6-4-3-5-7(2)27(6)9(28)11(19,20)13(23,24)14(25,26)12(21,22)10(17,18)8(15)16/h6-8H,3-5H2,1-2H3 |
| InChIKey | VYOCAAZIGCQVFK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|