C7H2F14O4S — CID 139595509
2-(1,1,2,2,3,3,4,4,5,5-decafluoropentoxy)-1,1,2,2-tetrafluoroethanesulfonic acid (PubChem CID 139595509) has the molecular formula C7H2F14O4S and a molecular weight of 448.13 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5-decafluoropentoxy)-1,1,2,2-tetrafluoroethanesulfonic acid.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5-decafluoropentoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 139595509 |
| Molecular Formula | C7H2F14O4S |
| Molecular Weight | 448.13 g/mol |
| Exact Mass | 447.95 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5-decafluoropentoxy)-1,1,2,2-tetrafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H2F14O4S/c8-1(9)2(10,11)3(12,13)4(14,15)5(16,17)25-6(18,19)7(20,21)26(22,23)24/h1H,(H,22,23,24) |
| InChIKey | IYAFCGZBAFKFSQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.13 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|