C6H3F11O4S — CID 19695004
1,1,2,3,3,4,4,5,5,6,6-undecafluoro-1-hydroxyhexane-2-sulfonic acid (PubChem CID 19695004) has the molecular formula C6H3F11O4S and a molecular weight of 380.13 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5,6,6-undecafluoro-1-hydroxyhexane-2-sulfonic acid.
| Compound Name | 1,1,2,3,3,4,4,5,5,6,6-undecafluoro-1-hydroxyhexane-2-sulfonic acid |
|---|---|
| PubChem CID | 19695004 |
| Molecular Formula | C6H3F11O4S |
| Molecular Weight | 380.13 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5,6,6-undecafluoro-1-hydroxyhexane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(C(O)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H3F11O4S/c7-1(8)2(9,10)3(11,12)4(13,14)5(15,6(16,17)18)22(19,20)21/h1,18H,(H,19,20,21) |
| InChIKey | ACQZHIVWAJAGLJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|